C18H25BO8S — CID 142587802
methyl 4-(acetyloxymethyl)-3-methylsulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (PubChem CID 142587802) has the molecular formula C18H25BO8S and a molecular weight of 412.27 g/mol. Its IUPAC name is methyl 4-(acetyloxymethyl)-3-methylsulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate.
| Compound Name | methyl 4-(acetyloxymethyl)-3-methylsulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
|---|---|
| PubChem CID | 142587802 |
| Molecular Formula | C18H25BO8S |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | methyl 4-(acetyloxymethyl)-3-methylsulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| SMILES | COC(=O)c1cc(B2OC(C)(C)C(C)(C)O2)c(COC(C)=O)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C18H25BO8S/c1-11(20)25-10-13-14(19-26-17(2,3)18(4,5)27-19)8-12(16(21)24-6)9-15(13)28(7,22)23/h8-9H,10H2,1-7H3 |
| InChIKey | CCAKLIRJHYJFFB-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|