C19H28BNO5 — CID 66816837
2-[N-acetyl-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]ethyl acetate (PubChem CID 66816837) has the molecular formula C19H28BNO5 and a molecular weight of 361.25 g/mol. Its IUPAC name is 2-[N-acetyl-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]ethyl acetate.
| Compound Name | 2-[N-acetyl-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]ethyl acetate |
|---|---|
| PubChem CID | 66816837 |
| Molecular Formula | C19H28BNO5 |
| Molecular Weight | 361.25 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | 2-[N-acetyl-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]ethyl acetate |
| SMILES | CC(=O)OCCN(C(C)=O)c1ccc(B2OC(C)(C)C(C)(C)O2)c(C)c1 |
| InChI | InChI=1S/C19H28BNO5/c1-13-12-16(21(14(2)22)10-11-24-15(3)23)8-9-17(13)20-25-18(4,5)19(6,7)26-20/h8-9,12H,10-11H2,1-7H3 |
| InChIKey | VKYIOPALVNURHB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|