C16H22BF2NO4 — CID 164888639
3-(difluoromethoxy)-N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (PubChem CID 164888639) has the molecular formula C16H22BF2NO4 and a molecular weight of 341.16 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide.
| Compound Name | 3-(difluoromethoxy)-N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
|---|---|
| PubChem CID | 164888639 |
| Molecular Formula | C16H22BF2NO4 |
| Molecular Weight | 341.16 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 3-(difluoromethoxy)-N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| SMILES | CN(C)C(=O)c1ccc(B2OC(C)(C)C(C)(C)O2)c(OC(F)F)c1 |
| InChI | InChI=1S/C16H22BF2NO4/c1-15(2)16(3,4)24-17(23-15)11-8-7-10(13(21)20(5)6)9-12(11)22-14(18)19/h7-9,14H,1-6H3 |
| InChIKey | LMHUUDAMQFNEIW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.16 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|