C13H16F6NO2P — CID 10428772
methyl 4-pyridin-1-ium-1-ylcyclohex-3-ene-1-carboxylate hexafluorophosphate (PubChem CID 10428772) has the molecular formula C13H16F6NO2P and a molecular weight of 363.24 g/mol. Its IUPAC name is methyl 4-pyridin-1-ium-1-ylcyclohex-3-ene-1-carboxylate hexafluorophosphate.
| Compound Name | methyl 4-pyridin-1-ium-1-ylcyclohex-3-ene-1-carboxylate hexafluorophosphate |
|---|---|
| PubChem CID | 10428772 |
| Molecular Formula | C13H16F6NO2P |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | methyl 4-pyridin-1-ium-1-ylcyclohex-3-ene-1-carboxylate hexafluorophosphate |
| SMILES | COC(=O)C1CC=C([n+]2ccccc2)CC1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C13H16NO2.F6P/c1-16-13(15)11-5-7-12(8-6-11)14-9-3-2-4-10-14;1-7(2,3,4,5)6/h2-4,7,9-11H,5-6,8H2,1H3;/q+1;-1 |
| InChIKey | BAELDFUYKIGSIS-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|