C13H14NO4+ — CID 102094924
(1R,2S)-4-pyridin-1-ium-1-ylcyclohex-4-ene-1,2-dicarboxylic acid (PubChem CID 102094924) has the molecular formula C13H14NO4+ and a molecular weight of 248.26 g/mol. Its IUPAC name is (1R,2S)-4-pyridin-1-ium-1-ylcyclohex-4-ene-1,2-dicarboxylic acid.
| Compound Name | (1R,2S)-4-pyridin-1-ium-1-ylcyclohex-4-ene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 102094924 |
| Molecular Formula | C13H14NO4+ |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | (1R,2S)-4-pyridin-1-ium-1-ylcyclohex-4-ene-1,2-dicarboxylic acid |
| SMILES | O=C(O)[C@H]1CC([n+]2ccccc2)=CC[C@H]1C(=O)O |
| InChI | InChI=1S/C13H13NO4/c15-12(16)10-5-4-9(8-11(10)13(17)18)14-6-2-1-3-7-14/h1-4,6-7,10-11H,5,8H2,(H-,15,16,17,18)/p+1/t10-,11+/m1/s1 |
| InChIKey | KVZNSFMKSYTKOT-MNOVXSKESA-O |
| XLogP | 1.01 |
| TPSA | 78.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|