C8H9Cl3O4Si — CID 70460197
4-trichlorosilylcyclohex-4-ene-1,2-dicarboxylic acid (PubChem CID 70460197) has the molecular formula C8H9Cl3O4Si and a molecular weight of 303.60 g/mol. Its IUPAC name is 4-trichlorosilylcyclohex-4-ene-1,2-dicarboxylic acid.
| Compound Name | 4-trichlorosilylcyclohex-4-ene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 70460197 |
| Molecular Formula | C8H9Cl3O4Si |
| Molecular Weight | 303.60 g/mol |
| Exact Mass | 301.93 |
| IUPAC Name | 4-trichlorosilylcyclohex-4-ene-1,2-dicarboxylic acid |
| SMILES | O=C(O)C1CC=C([Si](Cl)(Cl)Cl)CC1C(=O)O |
| InChI | InChI=1S/C8H9Cl3O4Si/c9-16(10,11)4-1-2-5(7(12)13)6(3-4)8(14)15/h1,5-6H,2-3H2,(H,12,13)(H,14,15) |
| InChIKey | DNAULGQDDPTVHT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.60 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|