C13H14BrNO4 — CID 10806153
(1S,2R)-4-pyridin-1-ium-1-ylcyclohex-4-ene-1,2-dicarboxylic acid bromide (PubChem CID 10806153) has the molecular formula C13H14BrNO4 and a molecular weight of 328.16 g/mol. Its IUPAC name is (1S,2R)-4-pyridin-1-ium-1-ylcyclohex-4-ene-1,2-dicarboxylic acid bromide.
| Compound Name | (1S,2R)-4-pyridin-1-ium-1-ylcyclohex-4-ene-1,2-dicarboxylic acid bromide |
|---|---|
| PubChem CID | 10806153 |
| Molecular Formula | C13H14BrNO4 |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | (1S,2R)-4-pyridin-1-ium-1-ylcyclohex-4-ene-1,2-dicarboxylic acid bromide |
| SMILES | O=C(O)[C@H]1CC=C([n+]2ccccc2)C[C@H]1C(=O)O.[Br-] |
| InChI | InChI=1S/C13H13NO4.BrH/c15-12(16)10-5-4-9(8-11(10)13(17)18)14-6-2-1-3-7-14;/h1-4,6-7,10-11H,5,8H2,(H-,15,16,17,18);1H/t10-,11+;/m0./s1 |
| InChIKey | HLYYXQUMELRJCS-VZXYPILPSA-N |
| XLogP | -1.99 |
| TPSA | 78.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|