C14H16BrNO4 — CID 10617245
(1R,2S)-4-methyl-5-pyridin-1-ium-1-ylcyclohex-4-ene-1,2-dicarboxylic acid bromide (PubChem CID 10617245) has the molecular formula C14H16BrNO4 and a molecular weight of 342.19 g/mol. Its IUPAC name is (1R,2S)-4-methyl-5-pyridin-1-ium-1-ylcyclohex-4-ene-1,2-dicarboxylic acid bromide.
| Compound Name | (1R,2S)-4-methyl-5-pyridin-1-ium-1-ylcyclohex-4-ene-1,2-dicarboxylic acid bromide |
|---|---|
| PubChem CID | 10617245 |
| Molecular Formula | C14H16BrNO4 |
| Molecular Weight | 342.19 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | (1R,2S)-4-methyl-5-pyridin-1-ium-1-ylcyclohex-4-ene-1,2-dicarboxylic acid bromide |
| SMILES | CC1=C([n+]2ccccc2)C[C@@H](C(=O)O)[C@@H](C(=O)O)C1.[Br-] |
| InChI | InChI=1S/C14H15NO4.BrH/c1-9-7-10(13(16)17)11(14(18)19)8-12(9)15-5-3-2-4-6-15;/h2-6,10-11H,7-8H2,1H3,(H-,16,17,18,19);1H/t10-,11+;/m0./s1 |
| InChIKey | VEHQEVGPWPDLQX-VZXYPILPSA-N |
| XLogP | -1.60 |
| TPSA | 78.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.19 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|