C34H56O — CID 162436727
[(1S,5S)-5-[(6E)-7,11-dimethyl-3-methylidenedodeca-6,10-dienyl]-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-1-methylcyclohex-3-en-1-yl]methanol (PubChem CID 162436727) has the molecular formula C34H56O and a molecular weight of 480.82 g/mol. Its IUPAC name is [(1S,5S)-5-[(6E)-7,11-dimethyl-3-methylidenedodeca-6,10-dienyl]-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-1-methylcyclohex-3-en-1-yl]methanol.
| Compound Name | [(1S,5S)-5-[(6E)-7,11-dimethyl-3-methylidenedodeca-6,10-dienyl]-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-1-methylcyclohex-3-en-1-yl]methanol |
|---|---|
| PubChem CID | 162436727 |
| Molecular Formula | C34H56O |
| Molecular Weight | 480.82 g/mol |
| Exact Mass | 480.43 |
| IUPAC Name | [(1S,5S)-5-[(6E)-7,11-dimethyl-3-methylidenedodeca-6,10-dienyl]-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-1-methylcyclohex-3-en-1-yl]methanol |
| SMILES | C=C(CC/C=C(\C)CCC=C(C)C)CC[C@@H]1C=C(CC/C=C(\C)CCC=C(C)C)C[C@@](C)(CO)C1 |
| InChI | InChI=1S/C34H56O/c1-27(2)13-9-15-29(5)17-11-18-31(7)21-22-33-23-32(24-34(8,25-33)26-35)20-12-19-30(6)16-10-14-28(3)4/h13-14,17,19,23,33,35H,7,9-12,15-16,18,20-22,24-26H2,1-6,8H3/b29-17+,30-19+/t33-,34-/m1/s1 |
| InChIKey | NGOZAUREZLUUBP-UBYKVRESSA-N |
| XLogP | 10.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.82 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|