C34H52O4 — CID 162436793
(1S,2S,3S)-3-[(6E)-7,11-dimethyl-3-methylidenedodeca-6,10-dienyl]-5-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-4-ene-1,2-dicarboxylic acid (PubChem CID 162436793) has the molecular formula C34H52O4 and a molecular weight of 524.79 g/mol. Its IUPAC name is (1S,2S,3S)-3-[(6E)-7,11-dimethyl-3-methylidenedodeca-6,10-dienyl]-5-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-4-ene-1,2-dicarboxylic acid.
| Compound Name | (1S,2S,3S)-3-[(6E)-7,11-dimethyl-3-methylidenedodeca-6,10-dienyl]-5-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-4-ene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 162436793 |
| Molecular Formula | C34H52O4 |
| Molecular Weight | 524.79 g/mol |
| Exact Mass | 524.39 |
| IUPAC Name | (1S,2S,3S)-3-[(6E)-7,11-dimethyl-3-methylidenedodeca-6,10-dienyl]-5-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-4-ene-1,2-dicarboxylic acid |
| SMILES | C=C(CC/C=C(\C)CCC=C(C)C)CC[C@H]1C=C(CC/C=C(\C)CCC=C(C)C)C[C@H](C(=O)O)[C@H]1C(=O)O |
| InChI | InChI=1S/C34H52O4/c1-24(2)12-8-14-26(5)16-10-17-28(7)20-21-30-22-29(23-31(33(35)36)32(30)34(37)38)19-11-18-27(6)15-9-13-25(3)4/h12-13,16,18,22,30-32H,7-11,14-15,17,19-21,23H2,1-6H3,(H,35,36)(H,37,38)/b26-16+,27-18+/t30-,31-,32-/m0/s1 |
| InChIKey | MPAZTQLAERQYBR-ZGNMKRJUSA-N |
| XLogP | 9.62 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.79 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|