C29H44O2 — CID 11407625
2,3,5-trimethyl-6-[(6E,10E)-7,11,15-trimethyl-3-methylidenehexadeca-6,10,14-trienyl]benzene-1,4-diol (PubChem CID 11407625) has the molecular formula C29H44O2 and a molecular weight of 424.67 g/mol. Its IUPAC name is 2,3,5-trimethyl-6-[(6E,10E)-7,11,15-trimethyl-3-methylidenehexadeca-6,10,14-trienyl]benzene-1,4-diol.
| Compound Name | 2,3,5-trimethyl-6-[(6E,10E)-7,11,15-trimethyl-3-methylidenehexadeca-6,10,14-trienyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 11407625 |
| Molecular Formula | C29H44O2 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.33 |
| IUPAC Name | 2,3,5-trimethyl-6-[(6E,10E)-7,11,15-trimethyl-3-methylidenehexadeca-6,10,14-trienyl]benzene-1,4-diol |
| SMILES | C=C(CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)CCc1c(C)c(O)c(C)c(C)c1O |
| InChI | InChI=1S/C29H44O2/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-17-23(5)18-19-27-26(8)28(30)24(6)25(7)29(27)31/h12,14,16,30-31H,5,9-11,13,15,17-19H2,1-4,6-8H3/b21-14+,22-16+ |
| InChIKey | MQRVVZCMDAQVNL-KTWAZNHYSA-N |
| XLogP | 8.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|