C26H32N4OS — CID 137235951
(6S)-6-[(1S,6R)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]-3-prop-2-enylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137235951) has the molecular formula C26H32N4OS and a molecular weight of 448.64 g/mol. Its IUPAC name is (6S)-6-[(1S,6R)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]-3-prop-2-enylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6S)-6-[(1S,6R)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]-3-prop-2-enylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137235951 |
| Molecular Formula | C26H32N4OS |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | (6S)-6-[(1S,6R)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]-3-prop-2-enylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | C=CCSC1=NN2C(=c3ccccc3=N[C@@H]2[C@H]2CC=C(CCC=C(C)C)C[C@H]2C)C(=O)N1 |
| InChI | InChI=1S/C26H32N4OS/c1-5-15-32-26-28-25(31)23-21-11-6-7-12-22(21)27-24(30(23)29-26)20-14-13-19(16-18(20)4)10-8-9-17(2)3/h5-7,9,11-13,18,20,24H,1,8,10,14-16H2,2-4H3,(H,28,29,31)/t18-,20+,24+/m1/s1 |
| InChIKey | STOHOMTWMVJZFT-WWEVIYMKSA-N |
| XLogP | 4.09 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|