C27H36N4OS — CID 137237855
(6S)-3-butylsulfanyl-6-[(1R,6S)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137237855) has the molecular formula C27H36N4OS and a molecular weight of 464.68 g/mol. Its IUPAC name is (6S)-3-butylsulfanyl-6-[(1R,6S)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6S)-3-butylsulfanyl-6-[(1R,6S)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137237855 |
| Molecular Formula | C27H36N4OS |
| Molecular Weight | 464.68 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | (6S)-3-butylsulfanyl-6-[(1R,6S)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCCCSC1=NN2C(=c3ccccc3=N[C@@H]2[C@@H]2CC=C(CCC=C(C)C)C[C@@H]2C)C(=O)N1 |
| InChI | InChI=1S/C27H36N4OS/c1-5-6-16-33-27-29-26(32)24-22-12-7-8-13-23(22)28-25(31(24)30-27)21-15-14-20(17-19(21)4)11-9-10-18(2)3/h7-8,10,12-14,19,21,25H,5-6,9,11,15-17H2,1-4H3,(H,29,30,32)/t19-,21+,25-/m0/s1 |
| InChIKey | ULLGJBJNODSNSS-HWHXTQLESA-N |
| XLogP | 4.71 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.68 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|