C20H24N4OS — CID 137235793
(6S)-6-[(1R,6S)-4,6-dimethylcyclohex-3-en-1-yl]-3-ethylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137235793) has the molecular formula C20H24N4OS and a molecular weight of 368.51 g/mol. Its IUPAC name is (6S)-6-[(1R,6S)-4,6-dimethylcyclohex-3-en-1-yl]-3-ethylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6S)-6-[(1R,6S)-4,6-dimethylcyclohex-3-en-1-yl]-3-ethylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137235793 |
| Molecular Formula | C20H24N4OS |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (6S)-6-[(1R,6S)-4,6-dimethylcyclohex-3-en-1-yl]-3-ethylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCSC1=NN2C(=c3ccccc3=N[C@@H]2[C@@H]2CC=C(C)C[C@@H]2C)C(=O)N1 |
| InChI | InChI=1S/C20H24N4OS/c1-4-26-20-22-19(25)17-15-7-5-6-8-16(15)21-18(24(17)23-20)14-10-9-12(2)11-13(14)3/h5-9,13-14,18H,4,10-11H2,1-3H3,(H,22,23,25)/t13-,14+,18-/m0/s1 |
| InChIKey | YQCCUVOXWRNKDT-IYOUNJFTSA-N |
| XLogP | 2.20 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|