C26H38O3 — CID 102299757
1-[(1S)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-3-en-1-yl]-2,4,5-trimethoxybenzene (PubChem CID 102299757) has the molecular formula C26H38O3 and a molecular weight of 398.59 g/mol. Its IUPAC name is 1-[(1S)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-3-en-1-yl]-2,4,5-trimethoxybenzene.
| Compound Name | 1-[(1S)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-3-en-1-yl]-2,4,5-trimethoxybenzene |
|---|---|
| PubChem CID | 102299757 |
| Molecular Formula | C26H38O3 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | 1-[(1S)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-3-en-1-yl]-2,4,5-trimethoxybenzene |
| SMILES | COc1cc(OC)c([C@H]2CCC=C(CC/C=C(\C)CCC=C(C)C)C2)cc1OC |
| InChI | InChI=1S/C26H38O3/c1-19(2)10-7-11-20(3)12-8-13-21-14-9-15-22(16-21)23-17-25(28-5)26(29-6)18-24(23)27-4/h10,12,14,17-18,22H,7-9,11,13,15-16H2,1-6H3/b20-12+/t22-/m0/s1 |
| InChIKey | UTEFJUZAGJLODE-PZDOZLBDSA-N |
| XLogP | 7.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|