C15H23LiO2S — CID 10333557
lithium 5-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methyl-2H-thiophen-5-ide 1,1-dioxide (PubChem CID 10333557) has the molecular formula C15H23LiO2S and a molecular weight of 274.35 g/mol. Its IUPAC name is lithium 5-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methyl-2H-thiophen-5-ide 1,1-dioxide.
| Compound Name | lithium 5-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methyl-2H-thiophen-5-ide 1,1-dioxide |
|---|---|
| PubChem CID | 10333557 |
| Molecular Formula | C15H23LiO2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | lithium 5-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methyl-2H-thiophen-5-ide 1,1-dioxide |
| SMILES | CC(C)=CCC/C(C)=C/C[C-]1C(C)=CCS1(=O)=O.[Li+] |
| InChI | InChI=1S/C15H23O2S.Li/c1-12(2)6-5-7-13(3)8-9-15-14(4)10-11-18(15,16)17;/h6,8,10H,5,7,9,11H2,1-4H3;/q-1;+1/b13-8+; |
| InChIKey | PKARONHYPXGZAT-FNXZNAJJSA-N |
| XLogP | 0.98 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|