C21H36O2 — CID 123356731
2-(3,7-dimethylocta-2,6-dienyl)-3-hydroxy-5-pentylcyclohexan-1-one (PubChem CID 123356731) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is 2-(3,7-dimethylocta-2,6-dienyl)-3-hydroxy-5-pentylcyclohexan-1-one.
| Compound Name | 2-(3,7-dimethylocta-2,6-dienyl)-3-hydroxy-5-pentylcyclohexan-1-one |
|---|---|
| PubChem CID | 123356731 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | 2-(3,7-dimethylocta-2,6-dienyl)-3-hydroxy-5-pentylcyclohexan-1-one |
| SMILES | CCCCCC1CC(=O)C(CC=C(C)CCC=C(C)C)C(O)C1 |
| InChI | InChI=1S/C21H36O2/c1-5-6-7-11-18-14-20(22)19(21(23)15-18)13-12-17(4)10-8-9-16(2)3/h9,12,18-20,22H,5-8,10-11,13-15H2,1-4H3 |
| InChIKey | BTZFXRRRTPIDPI-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|