C26H42O2 — CID 57035908
4-(3,7-dimethylocta-2,6-dienyl)-1-(2-methyl-5-propan-2-ylcyclohex-2-en-1-yl)hexane-1,5-dione (PubChem CID 57035908) has the molecular formula C26H42O2 and a molecular weight of 386.62 g/mol. Its IUPAC name is 4-(3,7-dimethylocta-2,6-dienyl)-1-(2-methyl-5-propan-2-ylcyclohex-2-en-1-yl)hexane-1,5-dione.
| Compound Name | 4-(3,7-dimethylocta-2,6-dienyl)-1-(2-methyl-5-propan-2-ylcyclohex-2-en-1-yl)hexane-1,5-dione |
|---|---|
| PubChem CID | 57035908 |
| Molecular Formula | C26H42O2 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.32 |
| IUPAC Name | 4-(3,7-dimethylocta-2,6-dienyl)-1-(2-methyl-5-propan-2-ylcyclohex-2-en-1-yl)hexane-1,5-dione |
| SMILES | CC(=O)C(CC=C(C)CCC=C(C)C)CCC(=O)C1CC(C(C)C)CC=C1C |
| InChI | InChI=1S/C26H42O2/c1-18(2)9-8-10-20(5)11-13-23(22(7)27)15-16-26(28)25-17-24(19(3)4)14-12-21(25)6/h9,11-12,19,23-25H,8,10,13-17H2,1-7H3 |
| InChIKey | AUZCOGLSJJYYMZ-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|