C29H44O2 — CID 67933965
2,3,3,4-tetramethyl-2-(4,8,12-trimethyltrideca-3,7,11-trienyl)-4H-chromen-6-ol (PubChem CID 67933965) has the molecular formula C29H44O2 and a molecular weight of 424.67 g/mol. Its IUPAC name is 2,3,3,4-tetramethyl-2-(4,8,12-trimethyltrideca-3,7,11-trienyl)-4H-chromen-6-ol.
| Compound Name | 2,3,3,4-tetramethyl-2-(4,8,12-trimethyltrideca-3,7,11-trienyl)-4H-chromen-6-ol |
|---|---|
| PubChem CID | 67933965 |
| Molecular Formula | C29H44O2 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.33 |
| IUPAC Name | 2,3,3,4-tetramethyl-2-(4,8,12-trimethyltrideca-3,7,11-trienyl)-4H-chromen-6-ol |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC1(C)Oc2ccc(O)cc2C(C)C1(C)C |
| InChI | InChI=1S/C29H44O2/c1-21(2)12-9-13-22(3)14-10-15-23(4)16-11-19-29(8)28(6,7)24(5)26-20-25(30)17-18-27(26)31-29/h12,14,16-18,20,24,30H,9-11,13,15,19H2,1-8H3 |
| InChIKey | ILORDYMVPIHFPV-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|