C24H30O4 — CID 162959945
(2S,3R)-2-(4,8-dimethylnona-3,7-dienyl)-7-hydroxy-2,3-dimethyl-3H-furo[2,3-b]chromen-4-one (PubChem CID 162959945) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is (2S,3R)-2-(4,8-dimethylnona-3,7-dienyl)-7-hydroxy-2,3-dimethyl-3H-furo[2,3-b]chromen-4-one.
| Compound Name | (2S,3R)-2-(4,8-dimethylnona-3,7-dienyl)-7-hydroxy-2,3-dimethyl-3H-furo[2,3-b]chromen-4-one |
|---|---|
| PubChem CID | 162959945 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | (2S,3R)-2-(4,8-dimethylnona-3,7-dienyl)-7-hydroxy-2,3-dimethyl-3H-furo[2,3-b]chromen-4-one |
| SMILES | CC(C)=CCCC(C)=CCC[C@]1(C)Oc2oc3cc(O)ccc3c(=O)c2[C@H]1C |
| InChI | InChI=1S/C24H30O4/c1-15(2)8-6-9-16(3)10-7-13-24(5)17(4)21-22(26)19-12-11-18(25)14-20(19)27-23(21)28-24/h8,10-12,14,17,25H,6-7,9,13H2,1-5H3/t17-,24+/m1/s1 |
| InChIKey | CCGSKBSMOVDXJF-OSPHWJPCSA-N |
| XLogP | 6.23 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|