C24H32O5 — CID 162990352
(3R,4S,5R)-3-(2,4-dihydroxybenzoyl)-5-(4,8-dimethylnona-3,7-dienyl)-4,5-dimethyloxolan-2-one (PubChem CID 162990352) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is (3R,4S,5R)-3-(2,4-dihydroxybenzoyl)-5-(4,8-dimethylnona-3,7-dienyl)-4,5-dimethyloxolan-2-one.
| Compound Name | (3R,4S,5R)-3-(2,4-dihydroxybenzoyl)-5-(4,8-dimethylnona-3,7-dienyl)-4,5-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 162990352 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | (3R,4S,5R)-3-(2,4-dihydroxybenzoyl)-5-(4,8-dimethylnona-3,7-dienyl)-4,5-dimethyloxolan-2-one |
| SMILES | CC(C)=CCCC(C)=CCC[C@@]1(C)OC(=O)[C@@H](C(=O)c2ccc(O)cc2O)[C@@H]1C |
| InChI | InChI=1S/C24H32O5/c1-15(2)8-6-9-16(3)10-7-13-24(5)17(4)21(23(28)29-24)22(27)19-12-11-18(25)14-20(19)26/h8,10-12,14,17,21,25-26H,6-7,9,13H2,1-5H3/t17-,21+,24+/m0/s1 |
| InChIKey | PUFZTKZBPIVBQR-XVWGUNQUSA-N |
| XLogP | 5.32 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|