C38H56O5 — CID 162869484
(2S)-1-(2,4-dihydroxyphenyl)-2-[3-[(2S,4R,5S)-4-hydroxy-5-methyl-5-(4-methylpent-3-enyl)oxolan-2-yl]but-2-enyl]-5,9,13-trimethyltetradeca-4,8,12-trien-1-one (PubChem CID 162869484) has the molecular formula C38H56O5 and a molecular weight of 592.86 g/mol. Its IUPAC name is (2S)-1-(2,4-dihydroxyphenyl)-2-[3-[(2S,4R,5S)-4-hydroxy-5-methyl-5-(4-methylpent-3-enyl)oxolan-2-yl]but-2-enyl]-5,9,13-trimethyltetradeca-4,8,12-trien-1-one.
| Compound Name | (2S)-1-(2,4-dihydroxyphenyl)-2-[3-[(2S,4R,5S)-4-hydroxy-5-methyl-5-(4-methylpent-3-enyl)oxolan-2-yl]but-2-enyl]-5,9,13-trimethyltetradeca-4,8,12-trien-1-one |
|---|---|
| PubChem CID | 162869484 |
| Molecular Formula | C38H56O5 |
| Molecular Weight | 592.86 g/mol |
| Exact Mass | 592.41 |
| IUPAC Name | (2S)-1-(2,4-dihydroxyphenyl)-2-[3-[(2S,4R,5S)-4-hydroxy-5-methyl-5-(4-methylpent-3-enyl)oxolan-2-yl]but-2-enyl]-5,9,13-trimethyltetradeca-4,8,12-trien-1-one |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CC[C@@H](CC=C(C)[C@@H]1C[C@@H](O)[C@](C)(CCC=C(C)C)O1)C(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C38H56O5/c1-26(2)12-9-14-28(5)15-10-16-29(6)17-19-31(37(42)33-22-21-32(39)24-34(33)40)20-18-30(7)35-25-36(41)38(8,43-35)23-11-13-27(3)4/h12-13,15,17-18,21-22,24,31,35-36,39-41H,9-11,14,16,19-20,23,25H2,1-8H3/t31-,35-,36+,38-/m0/s1 |
| InChIKey | DFJYDSSFPUWKBV-OSHIYGTBSA-N |
| XLogP | 9.70 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.86 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|