C25H34O6 — CID 101026971
(3R,4S,5R)-5-[(E)-4,8-dimethyl-6-oxonon-4-enyl]-3-(2-hydroxy-4-methoxybenzoyl)-4,5-dimethyloxolan-2-one (PubChem CID 101026971) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is (3R,4S,5R)-5-[(E)-4,8-dimethyl-6-oxonon-4-enyl]-3-(2-hydroxy-4-methoxybenzoyl)-4,5-dimethyloxolan-2-one.
| Compound Name | (3R,4S,5R)-5-[(E)-4,8-dimethyl-6-oxonon-4-enyl]-3-(2-hydroxy-4-methoxybenzoyl)-4,5-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 101026971 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | (3R,4S,5R)-5-[(E)-4,8-dimethyl-6-oxonon-4-enyl]-3-(2-hydroxy-4-methoxybenzoyl)-4,5-dimethyloxolan-2-one |
| SMILES | COc1ccc(C(=O)[C@@H]2C(=O)O[C@](C)(CCC/C(C)=C/C(=O)CC(C)C)[C@H]2C)c(O)c1 |
| InChI | InChI=1S/C25H34O6/c1-15(2)12-18(26)13-16(3)8-7-11-25(5)17(4)22(24(29)31-25)23(28)20-10-9-19(30-6)14-21(20)27/h9-10,13-15,17,22,27H,7-8,11-12H2,1-6H3/b16-13+/t17-,22+,25+/m0/s1 |
| InChIKey | RCBZGJUPMKCDAF-AKBGXECLSA-N |
| XLogP | 4.88 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|