C25H32O5 — CID 163045411
(2S,3R)-2-(8-hydroxy-4,8-dimethylnona-3,6-dienyl)-7-methoxy-2,3-dimethyl-3H-furo[2,3-b]chromen-4-one (PubChem CID 163045411) has the molecular formula C25H32O5 and a molecular weight of 412.53 g/mol. Its IUPAC name is (2S,3R)-2-(8-hydroxy-4,8-dimethylnona-3,6-dienyl)-7-methoxy-2,3-dimethyl-3H-furo[2,3-b]chromen-4-one.
| Compound Name | (2S,3R)-2-(8-hydroxy-4,8-dimethylnona-3,6-dienyl)-7-methoxy-2,3-dimethyl-3H-furo[2,3-b]chromen-4-one |
|---|---|
| PubChem CID | 163045411 |
| Molecular Formula | C25H32O5 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | (2S,3R)-2-(8-hydroxy-4,8-dimethylnona-3,6-dienyl)-7-methoxy-2,3-dimethyl-3H-furo[2,3-b]chromen-4-one |
| SMILES | COc1ccc2c(=O)c3c(oc2c1)O[C@@](C)(CCC=C(C)CC=CC(C)(C)O)[C@@H]3C |
| InChI | InChI=1S/C25H32O5/c1-16(9-7-13-24(3,4)27)10-8-14-25(5)17(2)21-22(26)19-12-11-18(28-6)15-20(19)29-23(21)30-25/h7,10-13,15,17,27H,8-9,14H2,1-6H3/t17-,25+/m1/s1 |
| InChIKey | CVQADAXRSHREJQ-NSYGIPOTSA-N |
| XLogP | 5.50 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|