C25H32O4 — CID 162930178
(2R,3S)-3-(4,8-dimethylnona-3,7-dienyl)-7-methoxy-2,3-dimethyl-2H-furo[3,2-c]chromen-4-one (PubChem CID 162930178) has the molecular formula C25H32O4 and a molecular weight of 396.53 g/mol. Its IUPAC name is (2R,3S)-3-(4,8-dimethylnona-3,7-dienyl)-7-methoxy-2,3-dimethyl-2H-furo[3,2-c]chromen-4-one.
| Compound Name | (2R,3S)-3-(4,8-dimethylnona-3,7-dienyl)-7-methoxy-2,3-dimethyl-2H-furo[3,2-c]chromen-4-one |
|---|---|
| PubChem CID | 162930178 |
| Molecular Formula | C25H32O4 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | (2R,3S)-3-(4,8-dimethylnona-3,7-dienyl)-7-methoxy-2,3-dimethyl-2H-furo[3,2-c]chromen-4-one |
| SMILES | COc1ccc2c3c(c(=O)oc2c1)[C@](C)(CCC=C(C)CCC=C(C)C)[C@@H](C)O3 |
| InChI | InChI=1S/C25H32O4/c1-16(2)9-7-10-17(3)11-8-14-25(5)18(4)28-23-20-13-12-19(27-6)15-21(20)29-24(26)22(23)25/h9,11-13,15,18H,7-8,10,14H2,1-6H3/t18-,25-/m1/s1 |
| InChIKey | OKCCQHCCOARNQY-IQGLISFBSA-N |
| XLogP | 6.31 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|