C24H26O6 — CID 162956192
(2R,3S)-7-hydroxy-2,3-dimethyl-2-[(E)-4-methyl-5-[(2R)-4-methyl-5-oxo-2H-furan-2-yl]pent-3-enyl]-3H-furo[3,2-c]chromen-4-one (PubChem CID 162956192) has the molecular formula C24H26O6 and a molecular weight of 410.47 g/mol. Its IUPAC name is (2R,3S)-7-hydroxy-2,3-dimethyl-2-[(E)-4-methyl-5-[(2R)-4-methyl-5-oxo-2H-furan-2-yl]pent-3-enyl]-3H-furo[3,2-c]chromen-4-one.
| Compound Name | (2R,3S)-7-hydroxy-2,3-dimethyl-2-[(E)-4-methyl-5-[(2R)-4-methyl-5-oxo-2H-furan-2-yl]pent-3-enyl]-3H-furo[3,2-c]chromen-4-one |
|---|---|
| PubChem CID | 162956192 |
| Molecular Formula | C24H26O6 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | (2R,3S)-7-hydroxy-2,3-dimethyl-2-[(E)-4-methyl-5-[(2R)-4-methyl-5-oxo-2H-furan-2-yl]pent-3-enyl]-3H-furo[3,2-c]chromen-4-one |
| SMILES | CC1=C[C@@H](C/C(C)=C/CC[C@@]2(C)Oc3c(c(=O)oc4cc(O)ccc34)[C@@H]2C)OC1=O |
| InChI | InChI=1S/C24H26O6/c1-13(10-17-11-14(2)22(26)28-17)6-5-9-24(4)15(3)20-21(30-24)18-8-7-16(25)12-19(18)29-23(20)27/h6-8,11-12,15,17,25H,5,9-10H2,1-4H3/b13-6+/t15-,17+,24+/m0/s1 |
| InChIKey | QZBUJGPGJAQWIM-IEQXWEAJSA-N |
| XLogP | 4.74 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|