C23H22O6 — CID 134836762
ethyl 3,9-dihydroxy-9-methyl-6-oxo-7-phenyl-8,10-dihydro-7H-benzo[c]chromene-8-carboxylate (PubChem CID 134836762) has the molecular formula C23H22O6 and a molecular weight of 394.42 g/mol. Its IUPAC name is ethyl 3,9-dihydroxy-9-methyl-6-oxo-7-phenyl-8,10-dihydro-7H-benzo[c]chromene-8-carboxylate.
| Compound Name | ethyl 3,9-dihydroxy-9-methyl-6-oxo-7-phenyl-8,10-dihydro-7H-benzo[c]chromene-8-carboxylate |
|---|---|
| PubChem CID | 134836762 |
| Molecular Formula | C23H22O6 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | ethyl 3,9-dihydroxy-9-methyl-6-oxo-7-phenyl-8,10-dihydro-7H-benzo[c]chromene-8-carboxylate |
| SMILES | CCOC(=O)C1C(c2ccccc2)c2c(c3ccc(O)cc3oc2=O)CC1(C)O |
| InChI | InChI=1S/C23H22O6/c1-3-28-22(26)20-18(13-7-5-4-6-8-13)19-16(12-23(20,2)27)15-10-9-14(24)11-17(15)29-21(19)25/h4-11,18,20,24,27H,3,12H2,1-2H3 |
| InChIKey | XTGJTBLXALEHQW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|