C15H10O4 — CID 89072166
3-hydroxy-6b,10a-dihydro-[1]benzofuro[3,2-c]chromen-6-one (PubChem CID 89072166) has the molecular formula C15H10O4 and a molecular weight of 254.24 g/mol. Its IUPAC name is 3-hydroxy-6b,10a-dihydro-[1]benzofuro[3,2-c]chromen-6-one.
| Compound Name | 3-hydroxy-6b,10a-dihydro-[1]benzofuro[3,2-c]chromen-6-one |
|---|---|
| PubChem CID | 89072166 |
| Molecular Formula | C15H10O4 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 3-hydroxy-6b,10a-dihydro-[1]benzofuro[3,2-c]chromen-6-one |
| SMILES | O=c1oc2cc(O)ccc2c2c1C1C=CC=CC1O2 |
| InChI | InChI=1S/C15H10O4/c16-8-5-6-10-12(7-8)19-15(17)13-9-3-1-2-4-11(9)18-14(10)13/h1-7,9,11,16H |
| InChIKey | RCBFTZZOOWGXJR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|