C28H36N2O4 — CID 143942458
3,10-dihydroxy-5-[(2E,6E)-11-hydroxy-3,7,11-trimethyldodeca-2,6-dienyl]-11H-benzo[b][1,4]benzodiazepin-6-one (PubChem CID 143942458) has the molecular formula C28H36N2O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is 3,10-dihydroxy-5-[(2E,6E)-11-hydroxy-3,7,11-trimethyldodeca-2,6-dienyl]-11H-benzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 3,10-dihydroxy-5-[(2E,6E)-11-hydroxy-3,7,11-trimethyldodeca-2,6-dienyl]-11H-benzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 143942458 |
| Molecular Formula | C28H36N2O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | 3,10-dihydroxy-5-[(2E,6E)-11-hydroxy-3,7,11-trimethyldodeca-2,6-dienyl]-11H-benzo[b][1,4]benzodiazepin-6-one |
| SMILES | C/C(=C\CN1C(=O)c2cccc(O)c2Nc2ccc(O)cc21)CC/C=C(\C)CCCC(C)(C)O |
| InChI | InChI=1S/C28H36N2O4/c1-19(10-7-16-28(3,4)34)8-5-9-20(2)15-17-30-24-18-21(31)13-14-23(24)29-26-22(27(30)33)11-6-12-25(26)32/h6,8,11-15,18,29,31-32,34H,5,7,9-10,16-17H2,1-4H3/b19-8+,20-15+ |
| InChIKey | JMLGTCZTHMQJMI-CDZADUSDSA-N |
| XLogP | 6.42 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|