C20H20N2O4 — CID 143942404
(E)-6-(3,10-dihydroxy-6-oxo-11H-benzo[b][1,4]benzodiazepin-5-yl)-4-methylhex-4-enal (PubChem CID 143942404) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is (E)-6-(3,10-dihydroxy-6-oxo-11H-benzo[b][1,4]benzodiazepin-5-yl)-4-methylhex-4-enal.
| Compound Name | (E)-6-(3,10-dihydroxy-6-oxo-11H-benzo[b][1,4]benzodiazepin-5-yl)-4-methylhex-4-enal |
|---|---|
| PubChem CID | 143942404 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | (E)-6-(3,10-dihydroxy-6-oxo-11H-benzo[b][1,4]benzodiazepin-5-yl)-4-methylhex-4-enal |
| SMILES | C/C(=C\CN1C(=O)c2cccc(O)c2Nc2ccc(O)cc21)CCC=O |
| InChI | InChI=1S/C20H20N2O4/c1-13(4-3-11-23)9-10-22-17-12-14(24)7-8-16(17)21-19-15(20(22)26)5-2-6-18(19)25/h2,5-9,11-12,21,24-25H,3-4,10H2,1H3/b13-9+ |
| InChIKey | KYFJHQDRSLGRPL-UKTHLTGXSA-N |
| XLogP | 3.73 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|