C10H19NO2 — CID 123772193
2-[5-(2-iminoethyl)-5-methyloxolan-2-yl]propan-2-ol (PubChem CID 123772193) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 2-[5-(2-iminoethyl)-5-methyloxolan-2-yl]propan-2-ol.
| Compound Name | 2-[5-(2-iminoethyl)-5-methyloxolan-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 123772193 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 2-[5-(2-iminoethyl)-5-methyloxolan-2-yl]propan-2-ol |
| SMILES | [H]/N=C/CC1(C)CCC(C(C)(C)O)O1 |
| InChI | InChI=1S/C10H19NO2/c1-9(2,12)8-4-5-10(3,13-8)6-7-11/h7-8,11-12H,4-6H2,1-3H3/b11-7+ |
| InChIKey | XQAQEXLOFJYOBI-YRNVUSSQSA-N |
| XLogP | 1.73 |
| TPSA | 53.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|