C15H25FO3 — CID 16720974
(E)-6-fluoro-1-[(2R,5R)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-4-methylhex-4-en-1-one (PubChem CID 16720974) has the molecular formula C15H25FO3 and a molecular weight of 272.36 g/mol. Its IUPAC name is (E)-6-fluoro-1-[(2R,5R)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-4-methylhex-4-en-1-one.
| Compound Name | (E)-6-fluoro-1-[(2R,5R)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-4-methylhex-4-en-1-one |
|---|---|
| PubChem CID | 16720974 |
| Molecular Formula | C15H25FO3 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | (E)-6-fluoro-1-[(2R,5R)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-4-methylhex-4-en-1-one |
| SMILES | C/C(=C\CF)CCC(=O)[C@@]1(C)CC[C@H](C(C)(C)O)O1 |
| InChI | InChI=1S/C15H25FO3/c1-11(8-10-16)5-6-12(17)15(4)9-7-13(19-15)14(2,3)18/h8,13,18H,5-7,9-10H2,1-4H3/b11-8+/t13-,15-/m1/s1 |
| InChIKey | HYTPDZZNTYRFAW-FQVLRVHISA-N |
| XLogP | 2.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|