C19H32N2O5 — CID 163141187
6-[5-(dihydroxyamino)-1H-pyrrol-3-yl]-1-[5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-4-methylhex-4-en-1-ol (PubChem CID 163141187) has the molecular formula C19H32N2O5 and a molecular weight of 368.47 g/mol. Its IUPAC name is 6-[5-(dihydroxyamino)-1H-pyrrol-3-yl]-1-[5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-4-methylhex-4-en-1-ol.
| Compound Name | 6-[5-(dihydroxyamino)-1H-pyrrol-3-yl]-1-[5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-4-methylhex-4-en-1-ol |
|---|---|
| PubChem CID | 163141187 |
| Molecular Formula | C19H32N2O5 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 6-[5-(dihydroxyamino)-1H-pyrrol-3-yl]-1-[5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-4-methylhex-4-en-1-ol |
| SMILES | CC(=CCc1c[nH]c(N(O)O)c1)CCC(O)C1(C)CCC(C(C)(C)O)O1 |
| InChI | InChI=1S/C19H32N2O5/c1-13(5-7-14-11-17(20-12-14)21(24)25)6-8-15(22)19(4)10-9-16(26-19)18(2,3)23/h5,11-12,15-16,20,22-25H,6-10H2,1-4H3 |
| InChIKey | JVHYIWDYQYMKGI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 109.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|