C19H30N2O3 — CID 163170420
4-[[(2R,3R)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]methyl]-N,N-dihydroxy-1H-pyrrol-2-amine (PubChem CID 163170420) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is 4-[[(2R,3R)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]methyl]-N,N-dihydroxy-1H-pyrrol-2-amine.
| Compound Name | 4-[[(2R,3R)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]methyl]-N,N-dihydroxy-1H-pyrrol-2-amine |
|---|---|
| PubChem CID | 163170420 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 4-[[(2R,3R)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]methyl]-N,N-dihydroxy-1H-pyrrol-2-amine |
| SMILES | CC(C)=CCC/C(C)=C/CC[C@@]1(C)O[C@@H]1Cc1c[nH]c(N(O)O)c1 |
| InChI | InChI=1S/C19H30N2O3/c1-14(2)7-5-8-15(3)9-6-10-19(4)17(24-19)11-16-12-18(20-13-16)21(22)23/h7,9,12-13,17,20,22-23H,5-6,8,10-11H2,1-4H3/b15-9+/t17-,19-/m1/s1 |
| InChIKey | VDMGJQWKLDDVRS-AXTVGJDGSA-N |
| XLogP | 4.77 |
| TPSA | 72.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|