C20H36O4 — CID 165104447
2-(5-ethenyl-5-methyloxolan-2-yl)propan-2-ol;6-ethenyl-2,2,6-trimethyloxan-3-ol (PubChem CID 165104447) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is 2-(5-ethenyl-5-methyloxolan-2-yl)propan-2-ol;6-ethenyl-2,2,6-trimethyloxan-3-ol.
| Compound Name | 2-(5-ethenyl-5-methyloxolan-2-yl)propan-2-ol;6-ethenyl-2,2,6-trimethyloxan-3-ol |
|---|---|
| PubChem CID | 165104447 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | 2-(5-ethenyl-5-methyloxolan-2-yl)propan-2-ol;6-ethenyl-2,2,6-trimethyloxan-3-ol |
| SMILES | C=CC1(C)CCC(C(C)(C)O)O1.C=CC1(C)CCC(O)C(C)(C)O1 |
| InChI | InChI=1S/2C10H18O2/c1-5-10(4)7-6-8(12-10)9(2,3)11;1-5-10(4)7-6-8(11)9(2,3)12-10/h2*5,8,11H,1,6-7H2,2-4H3 |
| InChIKey | YWVVPGLKOKWCKH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|