C16H30O4 — CID 170988930
(2S,3S,6S)-6-ethenyl-2-[(3S)-3-hydroxy-4-methoxy-4-methylpentyl]-2,6-dimethyloxan-3-ol (PubChem CID 170988930) has the molecular formula C16H30O4 and a molecular weight of 286.41 g/mol. Its IUPAC name is (2S,3S,6S)-6-ethenyl-2-[(3S)-3-hydroxy-4-methoxy-4-methylpentyl]-2,6-dimethyloxan-3-ol.
| Compound Name | (2S,3S,6S)-6-ethenyl-2-[(3S)-3-hydroxy-4-methoxy-4-methylpentyl]-2,6-dimethyloxan-3-ol |
|---|---|
| PubChem CID | 170988930 |
| Molecular Formula | C16H30O4 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | (2S,3S,6S)-6-ethenyl-2-[(3S)-3-hydroxy-4-methoxy-4-methylpentyl]-2,6-dimethyloxan-3-ol |
| SMILES | C=C[C@]1(C)CC[C@H](O)[C@](C)(CC[C@H](O)C(C)(C)OC)O1 |
| InChI | InChI=1S/C16H30O4/c1-7-15(4)10-8-13(18)16(5,20-15)11-9-12(17)14(2,3)19-6/h7,12-13,17-18H,1,8-11H2,2-6H3/t12-,13-,15+,16-/m0/s1 |
| InChIKey | DMUDDXOAWSGZTK-UGQVUOCMSA-N |
| XLogP | 2.43 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|