C7H11N — CID 163615440
2-[(1S,4R)-1-bicyclo[2.1.0]pentanyl]ethanimine (PubChem CID 163615440) has the molecular formula C7H11N and a molecular weight of 109.17 g/mol. Its IUPAC name is 2-[(1S,4R)-1-bicyclo[2.1.0]pentanyl]ethanimine.
| Compound Name | 2-[(1S,4R)-1-bicyclo[2.1.0]pentanyl]ethanimine |
|---|---|
| PubChem CID | 163615440 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | 2-[(1S,4R)-1-bicyclo[2.1.0]pentanyl]ethanimine |
| SMILES | [H]/N=C/C[C@@]12CC[C@@H]1C2 |
| InChI | InChI=1S/C7H11N/c8-4-3-7-2-1-6(7)5-7/h4,6,8H,1-3,5H2/b8-4+/t6-,7-/m1/s1 |
| InChIKey | HJOLPVIIRKYGFX-KFGJBHQHSA-N |
| XLogP | 1.83 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|