C10H15N — CID 156880564
2-(1-tricyclo[3.3.0.03,7]octanyl)ethanimine (PubChem CID 156880564) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 2-(1-tricyclo[3.3.0.03,7]octanyl)ethanimine.
| Compound Name | 2-(1-tricyclo[3.3.0.03,7]octanyl)ethanimine |
|---|---|
| PubChem CID | 156880564 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 2-(1-tricyclo[3.3.0.03,7]octanyl)ethanimine |
| SMILES | [H]/N=C/CC12CC3CC1CC3C2 |
| InChI | InChI=1S/C10H15N/c11-2-1-10-5-7-3-9(10)4-8(7)6-10/h2,7-9,11H,1,3-6H2/b11-2+ |
| InChIKey | RGLZZRHFXIFSOR-BIIKFXOESA-N |
| XLogP | 2.46 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|