About 1-adamantyl methanimidate
1-adamantyl methanimidate (PubChem CID 134861541) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 1-adamantyl methanimidate.
Molecular Properties
| Compound Name | 1-adamantyl methanimidate |
| PubChem CID | 134861541 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 1-adamantyl methanimidate |
| SMILES | [H]/N=C/OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C11H17NO/c12-7-13-11-4-8-1-9(5-11)3-10(2-8)6-11/h7-10,12H,1-6H2/b12-7+ |
| InChIKey | QEIWCVFSIPRVOW-KPKJPENVSA-N |
| XLogP | 2.58 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-adamantyl methanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantyl methanimidate?
The IUPAC name of 1-adamantyl methanimidate (CID 134861541) is 1-adamantyl methanimidate.
What is the SMILES notation for 1-adamantyl methanimidate?
The canonical SMILES for 1-adamantyl methanimidate is [H]/N=C/OC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-adamantyl methanimidate?
The InChIKey is QEIWCVFSIPRVOW-KPKJPENVSA-N. The full InChI is InChI=1S/C11H17NO/c12-7-13-11-4-8-1-9(5-11)3-10(2-8)6-11/h7-10,12H,1-6H2/b12-7+.
What are the key properties of 1-adamantyl methanimidate?
1-adamantyl methanimidate has a molecular weight of 179.26 g/mol, XLogP of 2.58, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantyl methanimidate is sourced from PubChem (CID 134861541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).