About [1-adamantyloxy(chloro)phosphoryl] hypochlorite
[1-adamantyloxy(chloro)phosphoryl] hypochlorite (PubChem CID 174641384) has the molecular formula C10H15Cl2O3P
and a molecular weight of 285.11 g/mol. Its IUPAC name is [1-adamantyloxy(chloro)phosphoryl] hypochlorite.
Molecular Properties
| Compound Name | [1-adamantyloxy(chloro)phosphoryl] hypochlorite |
| PubChem CID | 174641384 |
| Molecular Formula | C10H15Cl2O3P |
| Molecular Weight | 285.11 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | [1-adamantyloxy(chloro)phosphoryl] hypochlorite |
| SMILES | O=P(Cl)(OCl)OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C10H15Cl2O3P/c11-15-16(12,13)14-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9H,1-6H2 |
| InChIKey | IPZMSSWHMFEHKP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.11 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [1-adamantyloxy(chloro)phosphoryl] hypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-adamantyloxy(chloro)phosphoryl] hypochlorite?
The IUPAC name of [1-adamantyloxy(chloro)phosphoryl] hypochlorite (CID 174641384) is [1-adamantyloxy(chloro)phosphoryl] hypochlorite.
What is the SMILES notation for [1-adamantyloxy(chloro)phosphoryl] hypochlorite?
The canonical SMILES for [1-adamantyloxy(chloro)phosphoryl] hypochlorite is O=P(Cl)(OCl)OC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of [1-adamantyloxy(chloro)phosphoryl] hypochlorite?
The InChIKey is IPZMSSWHMFEHKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15Cl2O3P/c11-15-16(12,13)14-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9H,1-6H2.
What are the key properties of [1-adamantyloxy(chloro)phosphoryl] hypochlorite?
[1-adamantyloxy(chloro)phosphoryl] hypochlorite has a molecular weight of 285.11 g/mol, XLogP of 4.49, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-adamantyloxy(chloro)phosphoryl] hypochlorite is sourced from PubChem (CID 174641384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).