About 1-adamantyl ethenesulfonate
1-adamantyl ethenesulfonate (PubChem CID 20743856) has the molecular formula C12H18O3S
and a molecular weight of 242.34 g/mol. Its IUPAC name is 1-adamantyl ethenesulfonate.
Molecular Properties
| Compound Name | 1-adamantyl ethenesulfonate |
| PubChem CID | 20743856 |
| Molecular Formula | C12H18O3S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 1-adamantyl ethenesulfonate |
| SMILES | C=CS(=O)(=O)OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C12H18O3S/c1-2-16(13,14)15-12-6-9-3-10(7-12)5-11(4-9)8-12/h2,9-11H,1,3-8H2 |
| InChIKey | ZMLQKDUQOISPMV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 1-adamantyl ethenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantyl ethenesulfonate?
The IUPAC name of 1-adamantyl ethenesulfonate (CID 20743856) is 1-adamantyl ethenesulfonate.
What is the SMILES notation for 1-adamantyl ethenesulfonate?
The canonical SMILES for 1-adamantyl ethenesulfonate is C=CS(=O)(=O)OC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-adamantyl ethenesulfonate?
The InChIKey is ZMLQKDUQOISPMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3S/c1-2-16(13,14)15-12-6-9-3-10(7-12)5-11(4-9)8-12/h2,9-11H,1,3-8H2.
What are the key properties of 1-adamantyl ethenesulfonate?
1-adamantyl ethenesulfonate has a molecular weight of 242.34 g/mol, XLogP of 2.45, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantyl ethenesulfonate is sourced from PubChem (CID 20743856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).