About 1-adamantyl bis(triethylsilyl)methanesulfonate
1-adamantyl bis(triethylsilyl)methanesulfonate (PubChem CID 101224327) has the molecular formula C23H46O3SSi2
and a molecular weight of 458.86 g/mol. Its IUPAC name is 1-adamantyl bis(triethylsilyl)methanesulfonate.
Molecular Properties
| Compound Name | 1-adamantyl bis(triethylsilyl)methanesulfonate |
| PubChem CID | 101224327 |
| Molecular Formula | C23H46O3SSi2 |
| Molecular Weight | 458.86 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | 1-adamantyl bis(triethylsilyl)methanesulfonate |
| SMILES | CC[Si](CC)(CC)C([Si](CC)(CC)CC)S(=O)(=O)OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H46O3SSi2/c1-7-28(8-2,9-3)22(29(10-4,11-5)12-6)27(24,25)26-23-16-19-13-20(17-23)15-21(14-19)18-23/h19-22H,7-18H2,1-6H3 |
| InChIKey | MGNWYDJVMCUEJX-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.86 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 1-adamantyl bis(triethylsilyl)methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantyl bis(triethylsilyl)methanesulfonate?
The IUPAC name of 1-adamantyl bis(triethylsilyl)methanesulfonate (CID 101224327) is 1-adamantyl bis(triethylsilyl)methanesulfonate.
What is the SMILES notation for 1-adamantyl bis(triethylsilyl)methanesulfonate?
The canonical SMILES for 1-adamantyl bis(triethylsilyl)methanesulfonate is CC[Si](CC)(CC)C([Si](CC)(CC)CC)S(=O)(=O)OC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-adamantyl bis(triethylsilyl)methanesulfonate?
The InChIKey is MGNWYDJVMCUEJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H46O3SSi2/c1-7-28(8-2,9-3)22(29(10-4,11-5)12-6)27(24,25)26-23-16-19-13-20(17-23)15-21(14-19)18-23/h19-22H,7-18H2,1-6H3.
What are the key properties of 1-adamantyl bis(triethylsilyl)methanesulfonate?
1-adamantyl bis(triethylsilyl)methanesulfonate has a molecular weight of 458.86 g/mol, XLogP of 6.77, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantyl bis(triethylsilyl)methanesulfonate is sourced from PubChem (CID 101224327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).