C44H56O8 — CID 126482536
1-O-(1-adamantyl) 1-O'-[3-[1-(1-adamantyloxycarbonyl)-2-ethenylcyclopropanecarbonyl]oxy-1-adamantyl] 2-ethenylcyclopropane-1,1-dicarboxylate (PubChem CID 126482536) has the molecular formula C44H56O8 and a molecular weight of 712.92 g/mol. Its IUPAC name is 1-O-(1-adamantyl) 1-O'-[3-[1-(1-adamantyloxycarbonyl)-2-ethenylcyclopropanecarbonyl]oxy-1-adamantyl] 2-ethenylcyclopropane-1,1-dicarboxylate.
| Compound Name | 1-O-(1-adamantyl) 1-O'-[3-[1-(1-adamantyloxycarbonyl)-2-ethenylcyclopropanecarbonyl]oxy-1-adamantyl] 2-ethenylcyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 126482536 |
| Molecular Formula | C44H56O8 |
| Molecular Weight | 712.92 g/mol |
| Exact Mass | 712.40 |
| IUPAC Name | 1-O-(1-adamantyl) 1-O'-[3-[1-(1-adamantyloxycarbonyl)-2-ethenylcyclopropanecarbonyl]oxy-1-adamantyl] 2-ethenylcyclopropane-1,1-dicarboxylate |
| SMILES | C=CC1CC1(C(=O)OC12CC3CC(CC(C3)C1)C2)C(=O)OC12CC3CC(C1)CC(OC(=O)C1(C(=O)OC45CC6CC(CC(C6)C4)C5)CC1C=C)(C3)C2 |
| InChI | InChI=1S/C44H56O8/c1-3-33-22-43(33,35(45)49-39-12-25-5-26(13-39)7-27(6-25)14-39)37(47)51-41-18-31-11-32(19-41)21-42(20-31,24-41)52-38(48)44(23-34(44)4-2)36(46)50-40-15-28-8-29(16-40)10-30(9-28)17-40/h3-4,25-34H,1-2,5-24H2 |
| InChIKey | IDSWJXRPBKOGDB-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.92 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|