C18H23NO3 — CID 163495824
[3-(2-cyanoethoxy)-1-adamantyl] 2-methylidenebut-3-enoate (PubChem CID 163495824) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is [3-(2-cyanoethoxy)-1-adamantyl] 2-methylidenebut-3-enoate.
| Compound Name | [3-(2-cyanoethoxy)-1-adamantyl] 2-methylidenebut-3-enoate |
|---|---|
| PubChem CID | 163495824 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | [3-(2-cyanoethoxy)-1-adamantyl] 2-methylidenebut-3-enoate |
| SMILES | C=CC(=C)C(=O)OC12CC3CC(CC(OCCC#N)(C3)C1)C2 |
| InChI | InChI=1S/C18H23NO3/c1-3-13(2)16(20)22-18-10-14-7-15(11-18)9-17(8-14,12-18)21-6-4-5-19/h3,14-15H,1-2,4,6-12H2 |
| InChIKey | CQPOVDDYVKDNRL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|