C10H15NO — CID 167002514
1-(2-nitrosoethyl)tricyclo[3.3.0.03,7]octane (PubChem CID 167002514) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 1-(2-nitrosoethyl)tricyclo[3.3.0.03,7]octane.
| Compound Name | 1-(2-nitrosoethyl)tricyclo[3.3.0.03,7]octane |
|---|---|
| PubChem CID | 167002514 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 1-(2-nitrosoethyl)tricyclo[3.3.0.03,7]octane |
| SMILES | O=NCCC12CC3CC1CC3C2 |
| InChI | InChI=1S/C10H15NO/c12-11-2-1-10-5-7-3-9(10)4-8(7)6-10/h7-9H,1-6H2 |
| InChIKey | DHNKWEDEDJOMSS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |