About 1-(2-nitrosoethyl)tricyclo[3.3.0.03,7]octane
1-(2-nitrosoethyl)tricyclo[3.3.0.03,7]octane (PubChem CID 167002514) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is 1-(2-nitrosoethyl)tricyclo[3.3.0.03,7]octane.
Molecular Properties
| Compound Name | 1-(2-nitrosoethyl)tricyclo[3.3.0.03,7]octane |
| PubChem CID | 167002514 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 1-(2-nitrosoethyl)tricyclo[3.3.0.03,7]octane |
| SMILES | O=NCCC12CC3CC1CC3C2 |
| InChI | InChI=1S/C10H15NO/c12-11-2-1-10-5-7-3-9(10)4-8(7)6-10/h7-9H,1-6H2 |
| InChIKey | DHNKWEDEDJOMSS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-nitrosoethyl)tricyclo[3.3.0.03,7]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-nitrosoethyl)tricyclo[3.3.0.03,7]octane?
The IUPAC name of 1-(2-nitrosoethyl)tricyclo[3.3.0.03,7]octane (CID 167002514) is 1-(2-nitrosoethyl)tricyclo[3.3.0.03,7]octane.
What is the SMILES notation for 1-(2-nitrosoethyl)tricyclo[3.3.0.03,7]octane?
The canonical SMILES for 1-(2-nitrosoethyl)tricyclo[3.3.0.03,7]octane is O=NCCC12CC3CC1CC3C2.
What is the InChIKey of 1-(2-nitrosoethyl)tricyclo[3.3.0.03,7]octane?
The InChIKey is DHNKWEDEDJOMSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c12-11-2-1-10-5-7-3-9(10)4-8(7)6-10/h7-9H,1-6H2.
What are the key properties of 1-(2-nitrosoethyl)tricyclo[3.3.0.03,7]octane?
1-(2-nitrosoethyl)tricyclo[3.3.0.03,7]octane has a molecular weight of 165.24 g/mol, XLogP of 2.58, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-nitrosoethyl)tricyclo[3.3.0.03,7]octane is sourced from PubChem (CID 167002514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).