C16H20N4O4 — CID 172773224
1,2-bis(isocyanatomethyl)-5-(3-isocyanatopropyl)bicyclo[2.2.1]heptane;isocyanic acid (PubChem CID 172773224) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is 1,2-bis(isocyanatomethyl)-5-(3-isocyanatopropyl)bicyclo[2.2.1]heptane;isocyanic acid.
| Compound Name | 1,2-bis(isocyanatomethyl)-5-(3-isocyanatopropyl)bicyclo[2.2.1]heptane;isocyanic acid |
|---|---|
| PubChem CID | 172773224 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 1,2-bis(isocyanatomethyl)-5-(3-isocyanatopropyl)bicyclo[2.2.1]heptane;isocyanic acid |
| SMILES | N=C=O.O=C=NCCCC1CC2(CN=C=O)CC1CC2CN=C=O |
| InChI | InChI=1S/C15H19N3O3.CHNO/c19-9-16-3-1-2-12-5-15(8-18-11-21)6-13(12)4-14(15)7-17-10-20;2-1-3/h12-14H,1-8H2;2H |
| InChIKey | NFWWPGWPXQMNNX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 129.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|