C24H32N4O4 — CID 175187607
2,5-bis(isocyanatomethyl)-2-(3-isocyanatopropyl)bicyclo[2.2.1]heptane;1-(isocyanatomethyl)bicyclo[2.2.1]heptane (PubChem CID 175187607) has the molecular formula C24H32N4O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is 2,5-bis(isocyanatomethyl)-2-(3-isocyanatopropyl)bicyclo[2.2.1]heptane;1-(isocyanatomethyl)bicyclo[2.2.1]heptane.
| Compound Name | 2,5-bis(isocyanatomethyl)-2-(3-isocyanatopropyl)bicyclo[2.2.1]heptane;1-(isocyanatomethyl)bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 175187607 |
| Molecular Formula | C24H32N4O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 2,5-bis(isocyanatomethyl)-2-(3-isocyanatopropyl)bicyclo[2.2.1]heptane;1-(isocyanatomethyl)bicyclo[2.2.1]heptane |
| SMILES | O=C=NCC12CCC(CC1)C2.O=C=NCCCC1(CN=C=O)CC2CC1CC2CN=C=O |
| InChI | InChI=1S/C15H19N3O3.C9H13NO/c19-9-16-3-1-2-15(8-18-11-21)6-12-4-14(15)5-13(12)7-17-10-20;11-7-10-6-9-3-1-8(5-9)2-4-9/h12-14H,1-8H2;8H,1-6H2 |
| InChIKey | WUCDNVKIWKZNNB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 117.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|