About (1S,4R)-2,3-bis(isocyanatomethyl)bicyclo[2.2.1]heptane
(1S,4R)-2,3-bis(isocyanatomethyl)bicyclo[2.2.1]heptane (PubChem CID 10899769) has the molecular formula C11H14N2O2
and a molecular weight of 206.24 g/mol. Its IUPAC name is (1S,4R)-2,3-bis(isocyanatomethyl)bicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | (1S,4R)-2,3-bis(isocyanatomethyl)bicyclo[2.2.1]heptane |
| PubChem CID | 10899769 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | (1S,4R)-2,3-bis(isocyanatomethyl)bicyclo[2.2.1]heptane |
| SMILES | O=C=NCC1C(CN=C=O)[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C11H14N2O2/c14-6-12-4-10-8-1-2-9(3-8)11(10)5-13-7-15/h8-11H,1-5H2/t8-,9+,10?,11? |
| InChIKey | RBZIERZUJPGNBM-IXBNRNDTSA-N |
| XLogP | 1.32 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze (1S,4R)-2,3-bis(isocyanatomethyl)bicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,4R)-2,3-bis(isocyanatomethyl)bicyclo[2.2.1]heptane?
The IUPAC name of (1S,4R)-2,3-bis(isocyanatomethyl)bicyclo[2.2.1]heptane (CID 10899769) is (1S,4R)-2,3-bis(isocyanatomethyl)bicyclo[2.2.1]heptane.
What is the SMILES notation for (1S,4R)-2,3-bis(isocyanatomethyl)bicyclo[2.2.1]heptane?
The canonical SMILES for (1S,4R)-2,3-bis(isocyanatomethyl)bicyclo[2.2.1]heptane is O=C=NCC1C(CN=C=O)[C@H]2CC[C@@H]1C2.
What is the InChIKey of (1S,4R)-2,3-bis(isocyanatomethyl)bicyclo[2.2.1]heptane?
The InChIKey is RBZIERZUJPGNBM-IXBNRNDTSA-N. The full InChI is InChI=1S/C11H14N2O2/c14-6-12-4-10-8-1-2-9(3-8)11(10)5-13-7-15/h8-11H,1-5H2/t8-,9+,10?,11?.
What are the key properties of (1S,4R)-2,3-bis(isocyanatomethyl)bicyclo[2.2.1]heptane?
(1S,4R)-2,3-bis(isocyanatomethyl)bicyclo[2.2.1]heptane has a molecular weight of 206.24 g/mol, XLogP of 1.32, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,4R)-2,3-bis(isocyanatomethyl)bicyclo[2.2.1]heptane is sourced from PubChem (CID 10899769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).