C11H14N2O2 — CID 10899769
(1S,4R)-2,3-bis(isocyanatomethyl)bicyclo[2.2.1]heptane (PubChem CID 10899769) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is (1S,4R)-2,3-bis(isocyanatomethyl)bicyclo[2.2.1]heptane.
| Compound Name | (1S,4R)-2,3-bis(isocyanatomethyl)bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 10899769 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | (1S,4R)-2,3-bis(isocyanatomethyl)bicyclo[2.2.1]heptane |
| SMILES | O=C=NCC1C(CN=C=O)[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C11H14N2O2/c14-6-12-4-10-8-1-2-9(3-8)11(10)5-13-7-15/h8-11H,1-5H2/t8-,9+,10?,11? |
| InChIKey | RBZIERZUJPGNBM-IXBNRNDTSA-N |
| XLogP | 1.32 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|