C14H18N2O2 — CID 54529582
8,9-bis(isocyanatomethyl)tricyclo[5.2.1.02,6]decane (PubChem CID 54529582) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 8,9-bis(isocyanatomethyl)tricyclo[5.2.1.02,6]decane.
| Compound Name | 8,9-bis(isocyanatomethyl)tricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 54529582 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 8,9-bis(isocyanatomethyl)tricyclo[5.2.1.02,6]decane |
| SMILES | O=C=NCC1C(CN=C=O)C2CC1C1CCCC12 |
| InChI | InChI=1S/C14H18N2O2/c17-7-15-5-13-11-4-12(14(13)6-16-8-18)10-3-1-2-9(10)11/h9-14H,1-6H2 |
| InChIKey | YVOBVCXHPDFDJB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|