C18H28N2O2 — CID 150487523
2-cycloheptyl-1,4-bis(isocyanatomethyl)cycloheptane (PubChem CID 150487523) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 2-cycloheptyl-1,4-bis(isocyanatomethyl)cycloheptane.
| Compound Name | 2-cycloheptyl-1,4-bis(isocyanatomethyl)cycloheptane |
|---|---|
| PubChem CID | 150487523 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 2-cycloheptyl-1,4-bis(isocyanatomethyl)cycloheptane |
| SMILES | O=C=NCC1CCCC(CN=C=O)C(C2CCCCCC2)C1 |
| InChI | InChI=1S/C18H28N2O2/c21-13-19-11-15-6-5-9-17(12-20-14-22)18(10-15)16-7-3-1-2-4-8-16/h15-18H,1-12H2 |
| InChIKey | HVCJUHZKXSFEBN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|